About 3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile
3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile (PubChem CID 90908861) has the molecular formula C19H15N3O2
and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile |
| PubChem CID | 90908861 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile |
| SMILES | Cn1c(=O)cc(Cc2cccc(-c3cccc(C#N)c3)c2)[nH]c1=O |
| InChI | InChI=1S/C19H15N3O2/c1-22-18(23)11-17(21-19(22)24)10-13-4-2-6-15(8-13)16-7-3-5-14(9-16)12-20/h2-9,11H,10H2,1H3,(H,21,24) |
| InChIKey | OJAGDOWSFRXBHF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile?
The IUPAC name of 3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile (CID 90908861) is 3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile.
What is the SMILES notation for 3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile?
The canonical SMILES for 3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile is Cn1c(=O)cc(Cc2cccc(-c3cccc(C#N)c3)c2)[nH]c1=O.
What is the InChIKey of 3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile?
The InChIKey is OJAGDOWSFRXBHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O2/c1-22-18(23)11-17(21-19(22)24)10-13-4-2-6-15(8-13)16-7-3-5-14(9-16)12-20/h2-9,11H,10H2,1H3,(H,21,24).
What are the key properties of 3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile?
3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile has a molecular weight of 317.35 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(3-methyl-2,4-dioxo-1H-pyrimidin-6-yl)methyl]phenyl]benzonitrile is sourced from PubChem (CID 90908861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).