C19H19FN2O3 — CID 58608682
ethyl 2-[4-[[1-amino-3-(4-fluorophenyl)-3-oxopropylidene]amino]phenyl]acetate (PubChem CID 58608682) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is ethyl 2-[4-[[1-amino-3-(4-fluorophenyl)-3-oxopropylidene]amino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[1-amino-3-(4-fluorophenyl)-3-oxopropylidene]amino]phenyl]acetate |
|---|---|
| PubChem CID | 58608682 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | ethyl 2-[4-[[1-amino-3-(4-fluorophenyl)-3-oxopropylidene]amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(/N=C(\N)CC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H19FN2O3/c1-2-25-19(24)11-13-3-9-16(10-4-13)22-18(21)12-17(23)14-5-7-15(20)8-6-14/h3-10H,2,11-12H2,1H3,(H2,21,22) |
| InChIKey | DDBATFLKXLSGLB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|