C15H10F4N2O — CID 58608758
3-(4-fluorophenyl)-3-oxo-N'-(2,4,6-trifluorophenyl)propanimidamide (PubChem CID 58608758) has the molecular formula C15H10F4N2O and a molecular weight of 310.25 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-oxo-N'-(2,4,6-trifluorophenyl)propanimidamide.
| Compound Name | 3-(4-fluorophenyl)-3-oxo-N'-(2,4,6-trifluorophenyl)propanimidamide |
|---|---|
| PubChem CID | 58608758 |
| Molecular Formula | C15H10F4N2O |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-(4-fluorophenyl)-3-oxo-N'-(2,4,6-trifluorophenyl)propanimidamide |
| SMILES | N/C(CC(=O)c1ccc(F)cc1)=N/c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C15H10F4N2O/c16-9-3-1-8(2-4-9)13(22)7-14(20)21-15-11(18)5-10(17)6-12(15)19/h1-6H,7H2,(H2,20,21) |
| InChIKey | ZHQILAGSXFNPAH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|