C10H8N6O6S — CID 58610409
5-(1-ethyltetrazol-5-yl)sulfanyl-2,4-dinitrobenzoic acid (PubChem CID 58610409) has the molecular formula C10H8N6O6S and a molecular weight of 340.28 g/mol. Its IUPAC name is 5-(1-ethyltetrazol-5-yl)sulfanyl-2,4-dinitrobenzoic acid.
| Compound Name | 5-(1-ethyltetrazol-5-yl)sulfanyl-2,4-dinitrobenzoic acid |
|---|---|
| PubChem CID | 58610409 |
| Molecular Formula | C10H8N6O6S |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 5-(1-ethyltetrazol-5-yl)sulfanyl-2,4-dinitrobenzoic acid |
| SMILES | CCn1nnnc1Sc1cc(C(=O)O)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8N6O6S/c1-2-14-10(11-12-13-14)23-8-3-5(9(17)18)6(15(19)20)4-7(8)16(21)22/h3-4H,2H2,1H3,(H,17,18) |
| InChIKey | ARSYFKOQIJWTHU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 167.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|