C15H16F3NSi — CID 58611157
(E)-2,2,2-trifluoro-1-naphthalen-2-yl-N-trimethylsilylethanimine (PubChem CID 58611157) has the molecular formula C15H16F3NSi and a molecular weight of 295.38 g/mol. Its IUPAC name is (E)-2,2,2-trifluoro-1-naphthalen-2-yl-N-trimethylsilylethanimine.
| Compound Name | (E)-2,2,2-trifluoro-1-naphthalen-2-yl-N-trimethylsilylethanimine |
|---|---|
| PubChem CID | 58611157 |
| Molecular Formula | C15H16F3NSi |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (E)-2,2,2-trifluoro-1-naphthalen-2-yl-N-trimethylsilylethanimine |
| SMILES | C[Si](C)(C)/N=C(\c1ccc2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C15H16F3NSi/c1-20(2,3)19-14(15(16,17)18)13-9-8-11-6-4-5-7-12(11)10-13/h4-10H,1-3H3/b19-14+ |
| InChIKey | SFZRWWACHCKTJT-XMHGGMMESA-N |
| XLogP | 5.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|