C34H30BrN — CID 58611380
N-[4-[(E)-2-(8-bromonaphthalen-1-yl)ethenyl]phenyl]-3-ethyl-N-(3-ethylphenyl)aniline (PubChem CID 58611380) has the molecular formula C34H30BrN and a molecular weight of 532.53 g/mol. Its IUPAC name is N-[4-[(E)-2-(8-bromonaphthalen-1-yl)ethenyl]phenyl]-3-ethyl-N-(3-ethylphenyl)aniline.
| Compound Name | N-[4-[(E)-2-(8-bromonaphthalen-1-yl)ethenyl]phenyl]-3-ethyl-N-(3-ethylphenyl)aniline |
|---|---|
| PubChem CID | 58611380 |
| Molecular Formula | C34H30BrN |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | N-[4-[(E)-2-(8-bromonaphthalen-1-yl)ethenyl]phenyl]-3-ethyl-N-(3-ethylphenyl)aniline |
| SMILES | CCc1cccc(N(c2ccc(/C=C/c3cccc4cccc(Br)c34)cc2)c2cccc(CC)c2)c1 |
| InChI | InChI=1S/C34H30BrN/c1-3-25-9-5-14-31(23-25)36(32-15-6-10-26(4-2)24-32)30-21-18-27(19-22-30)17-20-29-12-7-11-28-13-8-16-33(35)34(28)29/h5-24H,3-4H2,1-2H3/b20-17+ |
| InChIKey | SWOKDNHVOYSCHW-LVZFUZTISA-N |
| XLogP | 10.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|