C20H26F16O8P2-2 — CID 58616426
[2-[5,8-diethyl-1,1,2,2,11,11,12,12-octafluoro-12-[1,1,2,2-tetrafluoro-2-[hydroxy(oxido)phosphoryl]ethoxy]dodecoxy]-1,1,2,2-tetrafluoroethyl]-hydroxyphosphinate (PubChem CID 58616426) has the molecular formula C20H26F16O8P2-2 and a molecular weight of 760.34 g/mol. Its IUPAC name is [2-[5,8-diethyl-1,1,2,2,11,11,12,12-octafluoro-12-[1,1,2,2-tetrafluoro-2-[hydroxy(oxido)phosphoryl]ethoxy]dodecoxy]-1,1,2,2-tetrafluoroethyl]-hydroxyphosphinate.
| Compound Name | [2-[5,8-diethyl-1,1,2,2,11,11,12,12-octafluoro-12-[1,1,2,2-tetrafluoro-2-[hydroxy(oxido)phosphoryl]ethoxy]dodecoxy]-1,1,2,2-tetrafluoroethyl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 58616426 |
| Molecular Formula | C20H26F16O8P2-2 |
| Molecular Weight | 760.34 g/mol |
| Exact Mass | 760.09 |
| IUPAC Name | [2-[5,8-diethyl-1,1,2,2,11,11,12,12-octafluoro-12-[1,1,2,2-tetrafluoro-2-[hydroxy(oxido)phosphoryl]ethoxy]dodecoxy]-1,1,2,2-tetrafluoroethyl]-hydroxyphosphinate |
| SMILES | CCC(CCC(CC)CCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)P(=O)([O-])O)CCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)P(=O)([O-])O |
| InChI | InChI=1S/C20H28F16O8P2/c1-3-11(7-9-13(21,22)15(25,26)43-17(29,30)19(33,34)45(37,38)39)5-6-12(4-2)8-10-14(23,24)16(27,28)44-18(31,32)20(35,36)46(40,41)42/h11-12H,3-10H2,1-2H3,(H2,37,38,39)(H2,40,41,42)/p-2 |
| InChIKey | NXISCRRANGRJCY-UHFFFAOYSA-L |
| XLogP | 7.33 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.34 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|