C8H2F16O8P2-2 — CID 58616420
hydroxy-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3,4,4-octafluoro-4-[1,1,2,2-tetrafluoro-2-[hydroxy(oxido)phosphoryl]ethoxy]butoxy]ethyl]phosphinate (PubChem CID 58616420) has the molecular formula C8H2F16O8P2-2 and a molecular weight of 592.01 g/mol. Its IUPAC name is hydroxy-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3,4,4-octafluoro-4-[1,1,2,2-tetrafluoro-2-[hydroxy(oxido)phosphoryl]ethoxy]butoxy]ethyl]phosphinate.
| Compound Name | hydroxy-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3,4,4-octafluoro-4-[1,1,2,2-tetrafluoro-2-[hydroxy(oxido)phosphoryl]ethoxy]butoxy]ethyl]phosphinate |
|---|---|
| PubChem CID | 58616420 |
| Molecular Formula | C8H2F16O8P2-2 |
| Molecular Weight | 592.01 g/mol |
| Exact Mass | 591.90 |
| IUPAC Name | hydroxy-[1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3,4,4-octafluoro-4-[1,1,2,2-tetrafluoro-2-[hydroxy(oxido)phosphoryl]ethoxy]butoxy]ethyl]phosphinate |
| SMILES | O=P([O-])(O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)P(=O)([O-])O |
| InChI | InChI=1S/C8H4F16O8P2/c9-1(10,3(13,14)31-5(17,18)7(21,22)33(25,26)27)2(11,12)4(15,16)32-6(19,20)8(23,24)34(28,29)30/h(H2,25,26,27)(H2,28,29,30)/p-2 |
| InChIKey | FJSFUPPGTGEUJO-UHFFFAOYSA-L |
| XLogP | 2.94 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.01 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|