C19H23N5 — CID 58617068
6-[(E)-hex-1-enyl]-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 58617068) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 6-[(E)-hex-1-enyl]-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-[(E)-hex-1-enyl]-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 58617068 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 6-[(E)-hex-1-enyl]-N-(2-pyridin-3-ylethyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | CCCC/C=C/c1cn2ccnc2c(NCCc2cccnc2)n1 |
| InChI | InChI=1S/C19H23N5/c1-2-3-4-5-8-17-15-24-13-12-22-19(24)18(23-17)21-11-9-16-7-6-10-20-14-16/h5-8,10,12-15H,2-4,9,11H2,1H3,(H,21,23)/b8-5+ |
| InChIKey | YNDIBSBAGFEBDB-VMPITWQZSA-N |
| XLogP | 3.98 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|