C27H29Cl3N2O3 — CID 58617625
2-[4-(4-chlorophenyl)piperidin-1-yl]-2-[1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperidin-4-yl]acetic acid (PubChem CID 58617625) has the molecular formula C27H29Cl3N2O3 and a molecular weight of 535.90 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)piperidin-1-yl]-2-[1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-(4-chlorophenyl)piperidin-1-yl]-2-[1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 58617625 |
| Molecular Formula | C27H29Cl3N2O3 |
| Molecular Weight | 535.90 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 2-[4-(4-chlorophenyl)piperidin-1-yl]-2-[1-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]piperidin-4-yl]acetic acid |
| SMILES | O=C(O)C(C1CCN(C(=O)/C=C/c2ccc(Cl)c(Cl)c2)CC1)N1CCC(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C27H29Cl3N2O3/c28-22-5-3-19(4-6-22)20-9-15-32(16-10-20)26(27(34)35)21-11-13-31(14-12-21)25(33)8-2-18-1-7-23(29)24(30)17-18/h1-8,17,20-21,26H,9-16H2,(H,34,35)/b8-2+ |
| InChIKey | NQKCRKPFGYJFJV-KRXBUXKQSA-N |
| XLogP | 6.23 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.90 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|