C13H23NO4 — CID 58618648
(2S,6R)-4-(hydroxymethyl)-6-(2-methylpiperidin-1-yl)cyclohex-4-ene-1,2,3-triol (PubChem CID 58618648) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is (2S,6R)-4-(hydroxymethyl)-6-(2-methylpiperidin-1-yl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (2S,6R)-4-(hydroxymethyl)-6-(2-methylpiperidin-1-yl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 58618648 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (2S,6R)-4-(hydroxymethyl)-6-(2-methylpiperidin-1-yl)cyclohex-4-ene-1,2,3-triol |
| SMILES | CC1CCCCN1[C@@H]1C=C(CO)C(O)[C@H](O)C1O |
| InChI | InChI=1S/C13H23NO4/c1-8-4-2-3-5-14(8)10-6-9(7-15)11(16)13(18)12(10)17/h6,8,10-13,15-18H,2-5,7H2,1H3/t8?,10-,11?,12?,13+/m1/s1 |
| InChIKey | KARSNNFCOVOPPT-BDAFETTDSA-N |
| XLogP | -0.76 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|