C37H30IrN3O2 — CID 58621573
iridium(3+);2-phenyl-6-(2-phenylethoxy)pyridine;2-phenyl-6-(2-pyridin-2-ylethoxy)pyridine (PubChem CID 58621573) has the molecular formula C37H30IrN3O2 and a molecular weight of 740.88 g/mol. Its IUPAC name is iridium(3+);2-phenyl-6-(2-phenylethoxy)pyridine;2-phenyl-6-(2-pyridin-2-ylethoxy)pyridine.
| Compound Name | iridium(3+);2-phenyl-6-(2-phenylethoxy)pyridine;2-phenyl-6-(2-pyridin-2-ylethoxy)pyridine |
|---|---|
| PubChem CID | 58621573 |
| Molecular Formula | C37H30IrN3O2 |
| Molecular Weight | 740.88 g/mol |
| Exact Mass | 741.20 |
| IUPAC Name | iridium(3+);2-phenyl-6-(2-phenylethoxy)pyridine;2-phenyl-6-(2-pyridin-2-ylethoxy)pyridine |
| SMILES | [Ir+3].[c-]1ccccc1-c1cccc(OCCc2ccccn2)n1.[c-]1ccccc1CCOc1cccc(-c2[c-]cccc2)n1 |
| InChI | InChI=1S/C19H15NO.C18H15N2O.Ir/c1-3-8-16(9-4-1)14-15-21-19-13-7-12-18(20-19)17-10-5-2-6-11-17;1-2-7-15(8-3-1)17-10-6-11-18(20-17)21-14-12-16-9-4-5-13-19-16;/h1-8,10,12-13H,14-15H2;1-7,9-11,13H,12,14H2;/q-2;-1;+3 |
| InChIKey | PQQJKCSQMWUNKV-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.88 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|