C24H32ClN3O2 — CID 58622185
tert-butyl (2S,3aS,7aS)-2-[[(6-chloroquinolin-2-yl)methylamino]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate (PubChem CID 58622185) has the molecular formula C24H32ClN3O2 and a molecular weight of 429.99 g/mol. Its IUPAC name is tert-butyl (2S,3aS,7aS)-2-[[(6-chloroquinolin-2-yl)methylamino]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate.
| Compound Name | tert-butyl (2S,3aS,7aS)-2-[[(6-chloroquinolin-2-yl)methylamino]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 58622185 |
| Molecular Formula | C24H32ClN3O2 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | tert-butyl (2S,3aS,7aS)-2-[[(6-chloroquinolin-2-yl)methylamino]methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CNCc2ccc3cc(Cl)ccc3n2)C[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C24H32ClN3O2/c1-24(2,3)30-23(29)28-20(13-17-6-4-5-7-22(17)28)15-26-14-19-10-8-16-12-18(25)9-11-21(16)27-19/h8-12,17,20,22,26H,4-7,13-15H2,1-3H3/t17-,20-,22-/m0/s1 |
| InChIKey | ICFGQINTNJSZRI-XJABCFGWSA-N |
| XLogP | 5.55 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |