C7H16N2 — CID 58622765
(3R,4S)-3,4-dimethylpiperidin-1-amine (PubChem CID 58622765) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is (3R,4S)-3,4-dimethylpiperidin-1-amine.
| Compound Name | (3R,4S)-3,4-dimethylpiperidin-1-amine |
|---|---|
| PubChem CID | 58622765 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | (3R,4S)-3,4-dimethylpiperidin-1-amine |
| SMILES | C[C@H]1CCN(N)C[C@@H]1C |
| InChI | InChI=1S/C7H16N2/c1-6-3-4-9(8)5-7(6)2/h6-7H,3-5,8H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | BVOBIEAAHDJBLR-BQBZGAKWSA-N |
| XLogP | 0.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|