C19H21BrO4S — CID 58623103
2,2-dimethylpropyl 2-[4-(4-bromophenyl)phenyl]sulfonylacetate (PubChem CID 58623103) has the molecular formula C19H21BrO4S and a molecular weight of 425.34 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[4-(4-bromophenyl)phenyl]sulfonylacetate.
| Compound Name | 2,2-dimethylpropyl 2-[4-(4-bromophenyl)phenyl]sulfonylacetate |
|---|---|
| PubChem CID | 58623103 |
| Molecular Formula | C19H21BrO4S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 2,2-dimethylpropyl 2-[4-(4-bromophenyl)phenyl]sulfonylacetate |
| SMILES | CC(C)(C)COC(=O)CS(=O)(=O)c1ccc(-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H21BrO4S/c1-19(2,3)13-24-18(21)12-25(22,23)17-10-6-15(7-11-17)14-4-8-16(20)9-5-14/h4-11H,12-13H2,1-3H3 |
| InChIKey | IAXXDSVCFYONNT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |