C32H35F5N2O4S — CID 58623122
tert-butyl 1-benzyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 58623122) has the molecular formula C32H35F5N2O4S and a molecular weight of 638.70 g/mol. Its IUPAC name is tert-butyl 1-benzyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 1-benzyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 58623122 |
| Molecular Formula | C32H35F5N2O4S |
| Molecular Weight | 638.70 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | tert-butyl 1-benzyl-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cn3)cc2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C32H35F5N2O4S/c1-29(2,3)43-28(40)30(17-19-39(20-18-30)22-24-7-5-4-6-8-24)44(41,42)26-12-10-25(11-13-26)27-14-9-23(21-38-27)15-16-31(33,34)32(35,36)37/h4-14,21H,15-20,22H2,1-3H3 |
| InChIKey | AITUETACGOHPSN-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.70 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|