C23H25F5O4S — CID 58623183
2,2-dimethylpropyl 2-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylacetate (PubChem CID 58623183) has the molecular formula C23H25F5O4S and a molecular weight of 492.51 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylacetate.
| Compound Name | 2,2-dimethylpropyl 2-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylacetate |
|---|---|
| PubChem CID | 58623183 |
| Molecular Formula | C23H25F5O4S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2,2-dimethylpropyl 2-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylacetate |
| SMILES | CC(C)(C)COC(=O)CS(=O)(=O)c1ccc(-c2ccc(CCC(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H25F5O4S/c1-21(2,3)15-32-20(29)14-33(30,31)19-10-8-18(9-11-19)17-6-4-16(5-7-17)12-13-22(24,25)23(26,27)28/h4-11H,12-15H2,1-3H3 |
| InChIKey | RMNKPYPVDBVXFR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|