C21H42O2Si2 — CID 58623324
tert-butyl-[(5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-methyloct-1-en-7-yn-3-yl]oxy-dimethylsilane (PubChem CID 58623324) has the molecular formula C21H42O2Si2 and a molecular weight of 382.74 g/mol. Its IUPAC name is tert-butyl-[(5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-methyloct-1-en-7-yn-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-methyloct-1-en-7-yn-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 58623324 |
| Molecular Formula | C21H42O2Si2 |
| Molecular Weight | 382.74 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | tert-butyl-[(5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-methyloct-1-en-7-yn-3-yl]oxy-dimethylsilane |
| SMILES | C#CC[C@](C)(CC(C=C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O2Si2/c1-14-16-21(9,23-25(12,13)20(6,7)8)17-18(15-2)22-24(10,11)19(3,4)5/h1,15,18H,2,16-17H2,3-13H3/t18?,21-/m1/s1 |
| InChIKey | LACJWUFNXSJRJQ-BDPMCISCSA-N |
| XLogP | 6.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.74 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|