C22H44O2Si2 — CID 134865990
triethyl-[(2S,3R)-2-ethynyl-3-triethylsilyloxyoct-7-en-2-yl]oxysilane (PubChem CID 134865990) has the molecular formula C22H44O2Si2 and a molecular weight of 396.76 g/mol. Its IUPAC name is triethyl-[(2S,3R)-2-ethynyl-3-triethylsilyloxyoct-7-en-2-yl]oxysilane.
| Compound Name | triethyl-[(2S,3R)-2-ethynyl-3-triethylsilyloxyoct-7-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 134865990 |
| Molecular Formula | C22H44O2Si2 |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | triethyl-[(2S,3R)-2-ethynyl-3-triethylsilyloxyoct-7-en-2-yl]oxysilane |
| SMILES | C#C[C@](C)(O[Si](CC)(CC)CC)[C@@H](CCCC=C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H44O2Si2/c1-10-18-19-20-21(23-25(12-3,13-4)14-5)22(9,11-2)24-26(15-6,16-7)17-8/h2,10,21H,1,12-20H2,3-9H3/t21-,22+/m1/s1 |
| InChIKey | UZAFTCHFIUYGFY-YADHBBJMSA-N |
| XLogP | 7.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|