C24H33N3O — CID 58625047
[4-amino-3-[[3-[cyclohexyl(methyl)amino]propylamino]methyl]phenyl]-phenylmethanone (PubChem CID 58625047) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is [4-amino-3-[[3-[cyclohexyl(methyl)amino]propylamino]methyl]phenyl]-phenylmethanone.
| Compound Name | [4-amino-3-[[3-[cyclohexyl(methyl)amino]propylamino]methyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 58625047 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | [4-amino-3-[[3-[cyclohexyl(methyl)amino]propylamino]methyl]phenyl]-phenylmethanone |
| SMILES | CN(CCCNCc1cc(C(=O)c2ccccc2)ccc1N)C1CCCCC1 |
| InChI | InChI=1S/C24H33N3O/c1-27(22-11-6-3-7-12-22)16-8-15-26-18-21-17-20(13-14-23(21)25)24(28)19-9-4-2-5-10-19/h2,4-5,9-10,13-14,17,22,26H,3,6-8,11-12,15-16,18,25H2,1H3 |
| InChIKey | WICBVZRUUWYEEE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|