C18H17F2N3O — CID 58625396
5-(2-aminophenoxy)-2-(2,2-difluoroethenyl)-4-[(dimethylamino)methyl]benzonitrile (PubChem CID 58625396) has the molecular formula C18H17F2N3O and a molecular weight of 329.35 g/mol. Its IUPAC name is 5-(2-aminophenoxy)-2-(2,2-difluoroethenyl)-4-[(dimethylamino)methyl]benzonitrile.
| Compound Name | 5-(2-aminophenoxy)-2-(2,2-difluoroethenyl)-4-[(dimethylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 58625396 |
| Molecular Formula | C18H17F2N3O |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 5-(2-aminophenoxy)-2-(2,2-difluoroethenyl)-4-[(dimethylamino)methyl]benzonitrile |
| SMILES | CN(C)Cc1cc(C=C(F)F)c(C#N)cc1Oc1ccccc1N |
| InChI | InChI=1S/C18H17F2N3O/c1-23(2)11-14-7-12(9-18(19)20)13(10-21)8-17(14)24-16-6-4-3-5-15(16)22/h3-9H,11,22H2,1-2H3 |
| InChIKey | VDQRJJFQNUARGV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|