C18H15F2N3O3 — CID 58625468
1-[2-[5-(2,2-difluoroethenyl)-4-isocyano-2-nitrophenoxy]phenyl]-N,N-dimethylmethanamine (PubChem CID 58625468) has the molecular formula C18H15F2N3O3 and a molecular weight of 359.33 g/mol. Its IUPAC name is 1-[2-[5-(2,2-difluoroethenyl)-4-isocyano-2-nitrophenoxy]phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-[5-(2,2-difluoroethenyl)-4-isocyano-2-nitrophenoxy]phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 58625468 |
| Molecular Formula | C18H15F2N3O3 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-[2-[5-(2,2-difluoroethenyl)-4-isocyano-2-nitrophenoxy]phenyl]-N,N-dimethylmethanamine |
| SMILES | [C-]#[N+]c1cc([N+](=O)[O-])c(Oc2ccccc2CN(C)C)cc1C=C(F)F |
| InChI | InChI=1S/C18H15F2N3O3/c1-21-14-10-15(23(24)25)17(8-13(14)9-18(19)20)26-16-7-5-4-6-12(16)11-22(2)3/h4-10H,11H2,2-3H3 |
| InChIKey | YHJAGMCLZMWFOM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 59.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|