C26H20FNO8 — CID 58627700
4-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoyl fluoride (PubChem CID 58627700) has the molecular formula C26H20FNO8 and a molecular weight of 493.44 g/mol. Its IUPAC name is 4-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoyl fluoride.
| Compound Name | 4-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoyl fluoride |
|---|---|
| PubChem CID | 58627700 |
| Molecular Formula | C26H20FNO8 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 4-[(6aR,10aS,11aR)-8-carbamoyl-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoyl fluoride |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(C(=O)F)cc5)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C26H20FNO8/c27-24(34)11-3-1-10(2-4-11)14-5-6-16(29)19-15(14)8-12-7-13-9-17(30)20(25(28)35)23(33)26(13,36)22(32)18(12)21(19)31/h1-6,12-13,29,31,33,36H,7-9H2,(H2,28,35)/t12-,13+,26+/m1/s1 |
| InChIKey | AZWLNMMOHLOYIP-ZCDIYMNCSA-N |
| XLogP | 2.20 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|