C13H10Cl2N4S — CID 58629016
5-chloro-N-[1-(2-chloro-3-pyridinyl)ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 58629016) has the molecular formula C13H10Cl2N4S and a molecular weight of 325.22 g/mol. Its IUPAC name is 5-chloro-N-[1-(2-chloro-3-pyridinyl)ethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-chloro-N-[1-(2-chloro-3-pyridinyl)ethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 58629016 |
| Molecular Formula | C13H10Cl2N4S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 5-chloro-N-[1-(2-chloro-3-pyridinyl)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(Nc1ncnc2scc(Cl)c12)c1cccnc1Cl |
| InChI | InChI=1S/C13H10Cl2N4S/c1-7(8-3-2-4-16-11(8)15)19-12-10-9(14)5-20-13(10)18-6-17-12/h2-7H,1H3,(H,17,18,19) |
| InChIKey | RVORRUOQDHOZQO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|