C21H39ClN4O2Si — CID 58630542
(2S)-2-[[2-chloro-6-(3-trimethylsilylpropyl)pyrimidin-4-yl]amino]-N-(3-ethoxypropyl)-4-methylpentanamide (PubChem CID 58630542) has the molecular formula C21H39ClN4O2Si and a molecular weight of 443.11 g/mol. Its IUPAC name is (2S)-2-[[2-chloro-6-(3-trimethylsilylpropyl)pyrimidin-4-yl]amino]-N-(3-ethoxypropyl)-4-methylpentanamide.
| Compound Name | (2S)-2-[[2-chloro-6-(3-trimethylsilylpropyl)pyrimidin-4-yl]amino]-N-(3-ethoxypropyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 58630542 |
| Molecular Formula | C21H39ClN4O2Si |
| Molecular Weight | 443.11 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | (2S)-2-[[2-chloro-6-(3-trimethylsilylpropyl)pyrimidin-4-yl]amino]-N-(3-ethoxypropyl)-4-methylpentanamide |
| SMILES | CCOCCCNC(=O)[C@H](CC(C)C)Nc1cc(CCC[Si](C)(C)C)nc(Cl)n1 |
| InChI | InChI=1S/C21H39ClN4O2Si/c1-7-28-12-9-11-23-20(27)18(14-16(2)3)25-19-15-17(24-21(22)26-19)10-8-13-29(4,5)6/h15-16,18H,7-14H2,1-6H3,(H,23,27)(H,24,25,26)/t18-/m0/s1 |
| InChIKey | VKJOCTRGBNSFCC-SFHVURJKSA-N |
| XLogP | 4.77 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.11 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|