C25H40N6O3 — CID 23568629
2-[[6-(cyclohexyloxymethyl)-2-imidazol-1-ylpyrimidin-4-yl]amino]-N-(3-ethoxypropyl)-4-methylpentanamide (PubChem CID 23568629) has the molecular formula C25H40N6O3 and a molecular weight of 472.63 g/mol. Its IUPAC name is 2-[[6-(cyclohexyloxymethyl)-2-imidazol-1-ylpyrimidin-4-yl]amino]-N-(3-ethoxypropyl)-4-methylpentanamide.
| Compound Name | 2-[[6-(cyclohexyloxymethyl)-2-imidazol-1-ylpyrimidin-4-yl]amino]-N-(3-ethoxypropyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 23568629 |
| Molecular Formula | C25H40N6O3 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | 2-[[6-(cyclohexyloxymethyl)-2-imidazol-1-ylpyrimidin-4-yl]amino]-N-(3-ethoxypropyl)-4-methylpentanamide |
| SMILES | CCOCCCNC(=O)C(CC(C)C)Nc1cc(COC2CCCCC2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C25H40N6O3/c1-4-33-14-8-11-27-24(32)22(15-19(2)3)29-23-16-20(17-34-21-9-6-5-7-10-21)28-25(30-23)31-13-12-26-18-31/h12-13,16,18-19,21-22H,4-11,14-15,17H2,1-3H3,(H,27,32)(H,28,29,30) |
| InChIKey | FUBOPCPVXYOSCJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|