C18H27ClN6OS — CID 22487591
2-[(6-chloro-2-imidazol-1-ylpyrimidin-4-yl)amino]-4,4-dimethyl-N-(3-methylsulfanylpropyl)pentanamide (PubChem CID 22487591) has the molecular formula C18H27ClN6OS and a molecular weight of 410.98 g/mol. Its IUPAC name is 2-[(6-chloro-2-imidazol-1-ylpyrimidin-4-yl)amino]-4,4-dimethyl-N-(3-methylsulfanylpropyl)pentanamide.
| Compound Name | 2-[(6-chloro-2-imidazol-1-ylpyrimidin-4-yl)amino]-4,4-dimethyl-N-(3-methylsulfanylpropyl)pentanamide |
|---|---|
| PubChem CID | 22487591 |
| Molecular Formula | C18H27ClN6OS |
| Molecular Weight | 410.98 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[(6-chloro-2-imidazol-1-ylpyrimidin-4-yl)amino]-4,4-dimethyl-N-(3-methylsulfanylpropyl)pentanamide |
| SMILES | CSCCCNC(=O)C(CC(C)(C)C)Nc1cc(Cl)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C18H27ClN6OS/c1-18(2,3)11-13(16(26)21-6-5-9-27-4)22-15-10-14(19)23-17(24-15)25-8-7-20-12-25/h7-8,10,12-13H,5-6,9,11H2,1-4H3,(H,21,26)(H,22,23,24) |
| InChIKey | FEPFIQHYKSCNBD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.98 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|