C9H18N2O3 — CID 58633155
tert-butyl N-[(2R,4E)-4-hydroxyiminobutan-2-yl]carbamate (PubChem CID 58633155) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is tert-butyl N-[(2R,4E)-4-hydroxyiminobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,4E)-4-hydroxyiminobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58633155 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | tert-butyl N-[(2R,4E)-4-hydroxyiminobutan-2-yl]carbamate |
| SMILES | C[C@H](C/C=N/O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H18N2O3/c1-7(5-6-10-13)11-8(12)14-9(2,3)4/h6-7,13H,5H2,1-4H3,(H,11,12)/b10-6+/t7-/m1/s1 |
| InChIKey | TUFWMYDNVQYLCN-VSUWBIFXSA-N |
| XLogP | 1.75 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|