C8H16N2O3 — CID 11229232
tert-butyl N-[(1E,2S)-1-hydroxyiminopropan-2-yl]carbamate (PubChem CID 11229232) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is tert-butyl N-[(1E,2S)-1-hydroxyiminopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1E,2S)-1-hydroxyiminopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 11229232 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | tert-butyl N-[(1E,2S)-1-hydroxyiminopropan-2-yl]carbamate |
| SMILES | C[C@@H](/C=N/O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C8H16N2O3/c1-6(5-9-12)10-7(11)13-8(2,3)4/h5-6,12H,1-4H3,(H,10,11)/b9-5+/t6-/m0/s1 |
| InChIKey | OVSNOLQVEQIMTO-HOITVRGQSA-N |
| XLogP | 1.36 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|