C30H44N4O7S — CID 58635629
N-[1-[[(4S,5R,6R,7R)-8-(benzylamino)-5,6-dihydroxy-2,7-dimethyl-8-oxooctan-4-yl]amino]-3-butylsulfonyl-1-oxopropan-2-yl]pyridine-3-carboxamide (PubChem CID 58635629) has the molecular formula C30H44N4O7S and a molecular weight of 604.77 g/mol. Its IUPAC name is N-[1-[[(4S,5R,6R,7R)-8-(benzylamino)-5,6-dihydroxy-2,7-dimethyl-8-oxooctan-4-yl]amino]-3-butylsulfonyl-1-oxopropan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-[[(4S,5R,6R,7R)-8-(benzylamino)-5,6-dihydroxy-2,7-dimethyl-8-oxooctan-4-yl]amino]-3-butylsulfonyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58635629 |
| Molecular Formula | C30H44N4O7S |
| Molecular Weight | 604.77 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | N-[1-[[(4S,5R,6R,7R)-8-(benzylamino)-5,6-dihydroxy-2,7-dimethyl-8-oxooctan-4-yl]amino]-3-butylsulfonyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
| SMILES | CCCCS(=O)(=O)CC(NC(=O)c1cccnc1)C(=O)N[C@@H](CC(C)C)[C@@H](O)[C@H](O)[C@@H](C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C30H44N4O7S/c1-5-6-15-42(40,41)19-25(34-29(38)23-13-10-14-31-18-23)30(39)33-24(16-20(2)3)27(36)26(35)21(4)28(37)32-17-22-11-8-7-9-12-22/h7-14,18,20-21,24-27,35-36H,5-6,15-17,19H2,1-4H3,(H,32,37)(H,33,39)(H,34,38)/t21-,24+,25?,26-,27-/m1/s1 |
| InChIKey | BTNYFUFUYDMXCC-JNEZDZFDSA-N |
| XLogP | 1.60 |
| TPSA | 174.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.77 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |