C35H44F2N4O5S — CID 142205148
N-[1-[[(2S,3R,4R,5R)-5-(benzylcarbamoyl)-1-(3,5-difluorophenyl)-3,4-dihydroxy-6-methylheptan-2-yl]amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide (PubChem CID 142205148) has the molecular formula C35H44F2N4O5S and a molecular weight of 670.82 g/mol. Its IUPAC name is N-[1-[[(2S,3R,4R,5R)-5-(benzylcarbamoyl)-1-(3,5-difluorophenyl)-3,4-dihydroxy-6-methylheptan-2-yl]amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-[[(2S,3R,4R,5R)-5-(benzylcarbamoyl)-1-(3,5-difluorophenyl)-3,4-dihydroxy-6-methylheptan-2-yl]amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142205148 |
| Molecular Formula | C35H44F2N4O5S |
| Molecular Weight | 670.82 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | N-[1-[[(2S,3R,4R,5R)-5-(benzylcarbamoyl)-1-(3,5-difluorophenyl)-3,4-dihydroxy-6-methylheptan-2-yl]amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
| SMILES | CCCCSCC(NC(=O)c1cccnc1)C(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@@H](O)[C@H](O)[C@H](C(=O)NCc1ccccc1)C(C)C |
| InChI | InChI=1S/C35H44F2N4O5S/c1-4-5-14-47-21-29(41-33(44)25-12-9-13-38-20-25)34(45)40-28(17-24-15-26(36)18-27(37)16-24)31(42)32(43)30(22(2)3)35(46)39-19-23-10-7-6-8-11-23/h6-13,15-16,18,20,22,28-32,42-43H,4-5,14,17,19,21H2,1-3H3,(H,39,46)(H,40,45)(H,41,44)/t28-,29?,30+,31+,32+/m0/s1 |
| InChIKey | FOSSRBZVNKSECC-JTLMUBJDSA-N |
| XLogP | 4.03 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.82 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|