C33H48F2N4O7S — CID 67564901
N-[(2S)-1-[[(2S,3R,4R,5R)-5-acetamido-1-(3,5-difluorophenyl)-3,4-dihydroxynonan-2-yl]amino]-3-heptan-4-ylsulfonyl-1-oxopropan-2-yl]pyridine-3-carboxamide (PubChem CID 67564901) has the molecular formula C33H48F2N4O7S and a molecular weight of 682.83 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S,3R,4R,5R)-5-acetamido-1-(3,5-difluorophenyl)-3,4-dihydroxynonan-2-yl]amino]-3-heptan-4-ylsulfonyl-1-oxopropan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[(2S)-1-[[(2S,3R,4R,5R)-5-acetamido-1-(3,5-difluorophenyl)-3,4-dihydroxynonan-2-yl]amino]-3-heptan-4-ylsulfonyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67564901 |
| Molecular Formula | C33H48F2N4O7S |
| Molecular Weight | 682.83 g/mol |
| Exact Mass | 682.32 |
| IUPAC Name | N-[(2S)-1-[[(2S,3R,4R,5R)-5-acetamido-1-(3,5-difluorophenyl)-3,4-dihydroxynonan-2-yl]amino]-3-heptan-4-ylsulfonyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
| SMILES | CCCC[C@@H](NC(C)=O)[C@@H](O)[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)[C@@H](CS(=O)(=O)C(CCC)CCC)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C33H48F2N4O7S/c1-5-8-13-27(37-21(4)40)30(41)31(42)28(17-22-15-24(34)18-25(35)16-22)38-33(44)29(39-32(43)23-12-9-14-36-19-23)20-47(45,46)26(10-6-2)11-7-3/h9,12,14-16,18-19,26-31,41-42H,5-8,10-11,13,17,20H2,1-4H3,(H,37,40)(H,38,44)(H,39,43)/t27-,28+,29-,30-,31-/m1/s1 |
| InChIKey | WOMFOUVLJUCLTM-OIERXHDDSA-N |
| XLogP | 2.99 |
| TPSA | 174.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.83 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |