C33H37F2N5O5S — CID 58651496
N-[(2S)-1-[[(2S,3R,4R,5R)-5-benzamido-6-cyano-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide (PubChem CID 58651496) has the molecular formula C33H37F2N5O5S and a molecular weight of 653.75 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S,3R,4R,5R)-5-benzamido-6-cyano-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[(2S)-1-[[(2S,3R,4R,5R)-5-benzamido-6-cyano-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58651496 |
| Molecular Formula | C33H37F2N5O5S |
| Molecular Weight | 653.75 g/mol |
| Exact Mass | 653.25 |
| IUPAC Name | N-[(2S)-1-[[(2S,3R,4R,5R)-5-benzamido-6-cyano-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
| SMILES | CCCCSC[C@@H](NC(=O)c1cccnc1)C(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@@H](O)[C@H](O)[C@@H](CC#N)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H37F2N5O5S/c1-2-3-14-46-20-28(40-32(44)23-10-7-13-37-19-23)33(45)39-27(17-21-15-24(34)18-25(35)16-21)30(42)29(41)26(11-12-36)38-31(43)22-8-5-4-6-9-22/h4-10,13,15-16,18-19,26-30,41-42H,2-3,11,14,17,20H2,1H3,(H,38,43)(H,39,45)(H,40,44)/t26-,27+,28-,29-,30-/m1/s1 |
| InChIKey | SWASQBXTALWOLL-ONBQWJCTSA-N |
| XLogP | 3.15 |
| TPSA | 164.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.75 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|