C34H46N4O5S2 — CID 142205565
N-[1-[(4-benzamido-2,3-dihydroxy-6-methylsulfanylhexyl)amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide;toluene (PubChem CID 142205565) has the molecular formula C34H46N4O5S2 and a molecular weight of 654.90 g/mol. Its IUPAC name is N-[1-[(4-benzamido-2,3-dihydroxy-6-methylsulfanylhexyl)amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide;toluene.
| Compound Name | N-[1-[(4-benzamido-2,3-dihydroxy-6-methylsulfanylhexyl)amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide;toluene |
|---|---|
| PubChem CID | 142205565 |
| Molecular Formula | C34H46N4O5S2 |
| Molecular Weight | 654.90 g/mol |
| Exact Mass | 654.29 |
| IUPAC Name | N-[1-[(4-benzamido-2,3-dihydroxy-6-methylsulfanylhexyl)amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide;toluene |
| SMILES | CCCCSCC(NC(=O)c1cccnc1)C(=O)NCC(O)C(O)C(CCSC)NC(=O)c1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C27H38N4O5S2.C7H8/c1-3-4-14-38-18-22(31-26(35)20-11-8-13-28-16-20)27(36)29-17-23(32)24(33)21(12-15-37-2)30-25(34)19-9-6-5-7-10-19;1-7-5-3-2-4-6-7/h5-11,13,16,21-24,32-33H,3-4,12,14-15,17-18H2,1-2H3,(H,29,36)(H,30,34)(H,31,35);2-6H,1H3 |
| InChIKey | ORITUPNQHHJECC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.90 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|