C32H54N4O5S — CID 142205123
N-[1-[[(4S,5R,6R,7R)-5,6-dihydroxy-2,8-dimethyl-7-(2-methylpropylcarbamoyl)non-8-en-4-yl]amino]-3-heptan-4-ylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide (PubChem CID 142205123) has the molecular formula C32H54N4O5S and a molecular weight of 606.87 g/mol. Its IUPAC name is N-[1-[[(4S,5R,6R,7R)-5,6-dihydroxy-2,8-dimethyl-7-(2-methylpropylcarbamoyl)non-8-en-4-yl]amino]-3-heptan-4-ylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-[[(4S,5R,6R,7R)-5,6-dihydroxy-2,8-dimethyl-7-(2-methylpropylcarbamoyl)non-8-en-4-yl]amino]-3-heptan-4-ylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142205123 |
| Molecular Formula | C32H54N4O5S |
| Molecular Weight | 606.87 g/mol |
| Exact Mass | 606.38 |
| IUPAC Name | N-[1-[[(4S,5R,6R,7R)-5,6-dihydroxy-2,8-dimethyl-7-(2-methylpropylcarbamoyl)non-8-en-4-yl]amino]-3-heptan-4-ylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
| SMILES | C=C(C)[C@@H](C(=O)NCC(C)C)[C@@H](O)[C@H](O)[C@H](CC(C)C)NC(=O)C(CSC(CCC)CCC)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C32H54N4O5S/c1-9-12-24(13-10-2)42-19-26(36-30(39)23-14-11-15-33-18-23)31(40)35-25(16-20(3)4)28(37)29(38)27(22(7)8)32(41)34-17-21(5)6/h11,14-15,18,20-21,24-29,37-38H,7,9-10,12-13,16-17,19H2,1-6,8H3,(H,34,41)(H,35,40)(H,36,39)/t25-,26?,27+,28+,29+/m0/s1 |
| InChIKey | XFGVAIXCTQOQQN-QDBAIAFLSA-N |
| XLogP | 4.10 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.87 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|