C34H44N4O6S — CID 58651487
N-[(2S)-1-[[(2S,3R,4R,5R)-5-benzamido-3,4-dihydroxy-7-methoxy-1-phenylheptan-2-yl]amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide (PubChem CID 58651487) has the molecular formula C34H44N4O6S and a molecular weight of 636.82 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S,3R,4R,5R)-5-benzamido-3,4-dihydroxy-7-methoxy-1-phenylheptan-2-yl]amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[(2S)-1-[[(2S,3R,4R,5R)-5-benzamido-3,4-dihydroxy-7-methoxy-1-phenylheptan-2-yl]amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58651487 |
| Molecular Formula | C34H44N4O6S |
| Molecular Weight | 636.82 g/mol |
| Exact Mass | 636.30 |
| IUPAC Name | N-[(2S)-1-[[(2S,3R,4R,5R)-5-benzamido-3,4-dihydroxy-7-methoxy-1-phenylheptan-2-yl]amino]-3-butylsulfanyl-1-oxopropan-2-yl]pyridine-3-carboxamide |
| SMILES | CCCCSC[C@@H](NC(=O)c1cccnc1)C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)[C@H](O)[C@@H](CCOC)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H44N4O6S/c1-3-4-20-45-23-29(38-33(42)26-16-11-18-35-22-26)34(43)37-28(21-24-12-7-5-8-13-24)31(40)30(39)27(17-19-44-2)36-32(41)25-14-9-6-10-15-25/h5-16,18,22,27-31,39-40H,3-4,17,19-21,23H2,1-2H3,(H,36,41)(H,37,43)(H,38,42)/t27-,28+,29-,30-,31-/m1/s1 |
| InChIKey | JLYUZMUHRBVOHX-OIERXHDDSA-N |
| XLogP | 3.00 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.82 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|