C16H27N3O3S — CID 110351535
(2S)-2-(butylsulfonylamino)-4-methyl-N-(pyridin-3-ylmethyl)pentanamide (PubChem CID 110351535) has the molecular formula C16H27N3O3S and a molecular weight of 341.48 g/mol. Its IUPAC name is (2S)-2-(butylsulfonylamino)-4-methyl-N-(pyridin-3-ylmethyl)pentanamide.
| Compound Name | (2S)-2-(butylsulfonylamino)-4-methyl-N-(pyridin-3-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 110351535 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (2S)-2-(butylsulfonylamino)-4-methyl-N-(pyridin-3-ylmethyl)pentanamide |
| SMILES | CCCCS(=O)(=O)N[C@@H](CC(C)C)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C16H27N3O3S/c1-4-5-9-23(21,22)19-15(10-13(2)3)16(20)18-12-14-7-6-8-17-11-14/h6-8,11,13,15,19H,4-5,9-10,12H2,1-3H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | LRMZOVJBIAEORO-HNNXBMFYSA-N |
| XLogP | 1.83 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |