C10H14N2 — CID 58637574
(9aR)-9a-methyl-3,4,6,9-tetrahydropyrido[2,3-c]azepine (PubChem CID 58637574) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (9aR)-9a-methyl-3,4,6,9-tetrahydropyrido[2,3-c]azepine.
| Compound Name | (9aR)-9a-methyl-3,4,6,9-tetrahydropyrido[2,3-c]azepine |
|---|---|
| PubChem CID | 58637574 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (9aR)-9a-methyl-3,4,6,9-tetrahydropyrido[2,3-c]azepine |
| SMILES | C[C@]12CN=CCC=C1CCC=N2 |
| InChI | InChI=1S/C10H14N2/c1-10-8-11-6-2-4-9(10)5-3-7-12-10/h4,6-7H,2-3,5,8H2,1H3/t10-/m0/s1 |
| InChIKey | NBQMYZPNRQPTJN-JTQLQIEISA-N |
| XLogP | 2.01 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|