C14H27N — CID 158184020
9a-methyl-3,4,6,9-tetrahydrocyclohepta[b]pyridine;methane (PubChem CID 158184020) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 9a-methyl-3,4,6,9-tetrahydrocyclohepta[b]pyridine;methane.
| Compound Name | 9a-methyl-3,4,6,9-tetrahydrocyclohepta[b]pyridine;methane |
|---|---|
| PubChem CID | 158184020 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 9a-methyl-3,4,6,9-tetrahydrocyclohepta[b]pyridine;methane |
| SMILES | C.C.C.CC12CC=CCC=C1CCC=N2 |
| InChI | InChI=1S/C11H15N.3CH4/c1-11-8-4-2-3-6-10(11)7-5-9-12-11;;;/h2,4,6,9H,3,5,7-8H2,1H3;3*1H4 |
| InChIKey | FYXVYVSDAMWCMG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|