C22H37NO3Si — CID 58641223
tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-2-phenylpyrrolidine-1-carboxylate (PubChem CID 58641223) has the molecular formula C22H37NO3Si and a molecular weight of 391.63 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-2-phenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-2-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58641223 |
| Molecular Formula | C22H37NO3Si |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-2-phenylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C22H37NO3Si/c1-20(2,3)25-19(24)23-16-18(26-27(8,9)21(4,5)6)15-22(23,7)17-13-11-10-12-14-17/h10-14,18H,15-16H2,1-9H3/t18-,22+/m1/s1 |
| InChIKey | JUHRXTRJDGRCED-GCJKJVERSA-N |
| XLogP | 5.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|