C22H33FN2O3Si — CID 66688414
tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(3-cyano-5-fluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 66688414) has the molecular formula C22H33FN2O3Si and a molecular weight of 420.60 g/mol. Its IUPAC name is tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(3-cyano-5-fluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(3-cyano-5-fluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66688414 |
| Molecular Formula | C22H33FN2O3Si |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-(3-cyano-5-fluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O[Si](C)(C)C(C)(C)C)CC1c1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C22H33FN2O3Si/c1-21(2,3)27-20(26)25-14-18(28-29(7,8)22(4,5)6)12-19(25)16-9-15(13-24)10-17(23)11-16/h9-11,18-19H,12,14H2,1-8H3 |
| InChIKey | NLZDVYNRIBQPOC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|