C13H6Cl2N2OS3 — CID 58643980
(5Z)-5-[[2-(2,4-dichlorophenyl)-1,3-thiazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 58643980) has the molecular formula C13H6Cl2N2OS3 and a molecular weight of 373.31 g/mol. Its IUPAC name is (5Z)-5-[[2-(2,4-dichlorophenyl)-1,3-thiazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[2-(2,4-dichlorophenyl)-1,3-thiazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58643980 |
| Molecular Formula | C13H6Cl2N2OS3 |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 371.90 |
| IUPAC Name | (5Z)-5-[[2-(2,4-dichlorophenyl)-1,3-thiazol-5-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1cnc(-c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C13H6Cl2N2OS3/c14-6-1-2-8(9(15)3-6)12-16-5-7(20-12)4-10-11(18)17-13(19)21-10/h1-5H,(H,17,18,19)/b10-4- |
| InChIKey | JUODIXNQYBECOE-WMZJFQQLSA-N |
| XLogP | 4.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|