C17H9ClF3NOS2 — CID 58644048
(5Z)-5-[[3-[3-chloro-4-(trifluoromethyl)phenyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 58644048) has the molecular formula C17H9ClF3NOS2 and a molecular weight of 399.85 g/mol. Its IUPAC name is (5Z)-5-[[3-[3-chloro-4-(trifluoromethyl)phenyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-[3-chloro-4-(trifluoromethyl)phenyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58644048 |
| Molecular Formula | C17H9ClF3NOS2 |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | (5Z)-5-[[3-[3-chloro-4-(trifluoromethyl)phenyl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1cccc(-c2ccc(C(F)(F)F)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H9ClF3NOS2/c18-13-8-11(4-5-12(13)17(19,20)21)10-3-1-2-9(6-10)7-14-15(23)22-16(24)25-14/h1-8H,(H,22,23,24)/b14-7- |
| InChIKey | LQBVESZTQIRCAU-AUWJEWJLSA-N |
| XLogP | 5.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|