C17H23NO3 — CID 58652936
(Z)-N-[1-(2,4-dimethylphenyl)ethyl]-3-hydroxy-N-methyl-4-oxohex-2-enamide (PubChem CID 58652936) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is (Z)-N-[1-(2,4-dimethylphenyl)ethyl]-3-hydroxy-N-methyl-4-oxohex-2-enamide.
| Compound Name | (Z)-N-[1-(2,4-dimethylphenyl)ethyl]-3-hydroxy-N-methyl-4-oxohex-2-enamide |
|---|---|
| PubChem CID | 58652936 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (Z)-N-[1-(2,4-dimethylphenyl)ethyl]-3-hydroxy-N-methyl-4-oxohex-2-enamide |
| SMILES | CCC(=O)/C(O)=C/C(=O)N(C)C(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C17H23NO3/c1-6-15(19)16(20)10-17(21)18(5)13(4)14-8-7-11(2)9-12(14)3/h7-10,13,20H,6H2,1-5H3/b16-10- |
| InChIKey | WRTIDBNQPGXSJD-YBEGLDIGSA-N |
| XLogP | 3.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|