C17H19FN2O3 — CID 58655010
N-(1-cyanoethyl)-3-[3-(2-fluoroethoxy)-4-prop-2-ynoxyphenyl]propanamide (PubChem CID 58655010) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is N-(1-cyanoethyl)-3-[3-(2-fluoroethoxy)-4-prop-2-ynoxyphenyl]propanamide.
| Compound Name | N-(1-cyanoethyl)-3-[3-(2-fluoroethoxy)-4-prop-2-ynoxyphenyl]propanamide |
|---|---|
| PubChem CID | 58655010 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-(1-cyanoethyl)-3-[3-(2-fluoroethoxy)-4-prop-2-ynoxyphenyl]propanamide |
| SMILES | C#CCOc1ccc(CCC(=O)NC(C)C#N)cc1OCCF |
| InChI | InChI=1S/C17H19FN2O3/c1-3-9-22-15-6-4-14(11-16(15)23-10-8-18)5-7-17(21)20-13(2)12-19/h1,4,6,11,13H,5,7-10H2,2H3,(H,20,21) |
| InChIKey | KBDPCBHDVUWZAF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|