C16H19N3O3 — CID 58655050
N-(1-cyanoethyl)-3-[4-(cyanomethoxy)-3-ethoxyphenyl]propanamide (PubChem CID 58655050) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(1-cyanoethyl)-3-[4-(cyanomethoxy)-3-ethoxyphenyl]propanamide.
| Compound Name | N-(1-cyanoethyl)-3-[4-(cyanomethoxy)-3-ethoxyphenyl]propanamide |
|---|---|
| PubChem CID | 58655050 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-(1-cyanoethyl)-3-[4-(cyanomethoxy)-3-ethoxyphenyl]propanamide |
| SMILES | CCOc1cc(CCC(=O)NC(C)C#N)ccc1OCC#N |
| InChI | InChI=1S/C16H19N3O3/c1-3-21-15-10-13(4-6-14(15)22-9-8-17)5-7-16(20)19-12(2)11-18/h4,6,10,12H,3,5,7,9H2,1-2H3,(H,19,20) |
| InChIKey | SWEUKRRTDJMGQP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |