C20H21ClN2O3 — CID 23103259
N-[(4-chlorophenyl)-cyanomethyl]-3-(4-ethoxy-3-methoxyphenyl)propanamide (PubChem CID 23103259) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-cyanomethyl]-3-(4-ethoxy-3-methoxyphenyl)propanamide.
| Compound Name | N-[(4-chlorophenyl)-cyanomethyl]-3-(4-ethoxy-3-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 23103259 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-[(4-chlorophenyl)-cyanomethyl]-3-(4-ethoxy-3-methoxyphenyl)propanamide |
| SMILES | CCOc1ccc(CCC(=O)NC(C#N)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C20H21ClN2O3/c1-3-26-18-10-4-14(12-19(18)25-2)5-11-20(24)23-17(13-22)15-6-8-16(21)9-7-15/h4,6-10,12,17H,3,5,11H2,1-2H3,(H,23,24) |
| InChIKey | QZVOHLDFYIAPIH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |