C21H18Cl2N2O3 — CID 58655040
3-(2-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-N-[(4-chlorophenyl)-cyanomethyl]propanamide (PubChem CID 58655040) has the molecular formula C21H18Cl2N2O3 and a molecular weight of 417.29 g/mol. Its IUPAC name is 3-(2-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-N-[(4-chlorophenyl)-cyanomethyl]propanamide.
| Compound Name | 3-(2-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-N-[(4-chlorophenyl)-cyanomethyl]propanamide |
|---|---|
| PubChem CID | 58655040 |
| Molecular Formula | C21H18Cl2N2O3 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 3-(2-chloro-5-methoxy-4-prop-2-ynoxyphenyl)-N-[(4-chlorophenyl)-cyanomethyl]propanamide |
| SMILES | C#CCOc1cc(Cl)c(CCC(=O)NC(C#N)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C21H18Cl2N2O3/c1-3-10-28-20-12-17(23)15(11-19(20)27-2)6-9-21(26)25-18(13-24)14-4-7-16(22)8-5-14/h1,4-5,7-8,11-12,18H,6,9-10H2,2H3,(H,25,26) |
| InChIKey | HKMOJJJCNXSLPG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|