C16H13Cl2N7O4S2 — CID 58656103
N-[5-[2-azido-2-(1,3-oxazol-2-yl)ethyl]sulfanyl-3-methoxypyrazin-2-yl]-2,3-dichlorobenzenesulfonamide (PubChem CID 58656103) has the molecular formula C16H13Cl2N7O4S2 and a molecular weight of 502.37 g/mol. Its IUPAC name is N-[5-[2-azido-2-(1,3-oxazol-2-yl)ethyl]sulfanyl-3-methoxypyrazin-2-yl]-2,3-dichlorobenzenesulfonamide.
| Compound Name | N-[5-[2-azido-2-(1,3-oxazol-2-yl)ethyl]sulfanyl-3-methoxypyrazin-2-yl]-2,3-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 58656103 |
| Molecular Formula | C16H13Cl2N7O4S2 |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 500.98 |
| IUPAC Name | N-[5-[2-azido-2-(1,3-oxazol-2-yl)ethyl]sulfanyl-3-methoxypyrazin-2-yl]-2,3-dichlorobenzenesulfonamide |
| SMILES | COc1nc(SCC(N=[N+]=[N-])c2ncco2)cnc1NS(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H13Cl2N7O4S2/c1-28-16-14(24-31(26,27)11-4-2-3-9(17)13(11)18)21-7-12(22-16)30-8-10(23-25-19)15-20-5-6-29-15/h2-7,10H,8H2,1H3,(H,21,24) |
| InChIKey | ZSPPMNIWMUDVIV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 155.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|