C24H33N3O4 — CID 58656254
methyl N-[4-[(3S)-3-[(4-hydroxyadamantane-1-carbonyl)amino]piperidin-1-yl]phenyl]carbamate (PubChem CID 58656254) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is methyl N-[4-[(3S)-3-[(4-hydroxyadamantane-1-carbonyl)amino]piperidin-1-yl]phenyl]carbamate.
| Compound Name | methyl N-[4-[(3S)-3-[(4-hydroxyadamantane-1-carbonyl)amino]piperidin-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 58656254 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | methyl N-[4-[(3S)-3-[(4-hydroxyadamantane-1-carbonyl)amino]piperidin-1-yl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(N2CCC[C@H](NC(=O)C34CC5CC(C3)C(O)C(C5)C4)C2)cc1 |
| InChI | InChI=1S/C24H33N3O4/c1-31-23(30)26-18-4-6-20(7-5-18)27-8-2-3-19(14-27)25-22(29)24-11-15-9-16(12-24)21(28)17(10-15)13-24/h4-7,15-17,19,21,28H,2-3,8-14H2,1H3,(H,25,29)(H,26,30)/t15?,16?,17?,19-,21?,24?/m0/s1 |
| InChIKey | ASPRAOKCQDKCPH-UJWOUVLOSA-N |
| XLogP | 3.14 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|